What is the name of C3H7COO?
Sodium butyrate is a compound with formula Na(C3H7COO). It is the sodium salt of butyric acid.
What is the name of C4O6?
Ethylendicarbonate
Ethylendicarbonate | C4O6 – PubChem.
What is the name of C11H20?
1-Undecyne
1-Undecyne | C11H20 – PubChem.
What is the name of al3o3?
Sodium aluminate is an inorganic chemical that is used as an effective source of aluminium hydroxide for many industrial and technical applications.
What is ch3cooc3h7?
It is the ester of propanol and ethanoic acid. Its IUPAC name is propyl ethanoate.
What is the IUPAC name of acetamide?
| IUPAC Name | acetamide |
|---|---|
| Alternative Names | acetamide Ethanamide Acetic acid amide Methanecarboxamide Acetimidic acid |
| Molecular Formula | C2H5NO |
| Molar Mass | 59.068 g/mol |
| InChI | InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4) |
What is an example of covalent compound?
Covalent compound examples include water, ammonia, chlorine gas, and nitrogen gas. Covalent compounds or molecular compounds are chemical compounds made of elements connected by covalent bonds.
What is CH3COOCH2CH2CH3?
acetic acid propyl. n-propanol acetate. Propyl acetate, 99% CH3COOCH2CH2CH3.
What is PR in organic chemistry?
Propyl (propyl group; Pr): A portion of a molecular structure equivalent to propane minus one methyl group hydrogen atom: -CH2CH2CH3. Sometimes abbreviated as Pr. Propane. Propyl group.
What is the formula of acetamide?
C2H5NOAcetamide / Formula
What is the functional group of acetamide?
carboxylic acid amide functional group
Acetamide Formula and Structure The acetamide has a methyl group (-CH3) bound to a carbonyl (CO) and Amine (NH2). Besides, the acetamide primarily comprises of carboxylic acid amide functional group that has a general structure RC (=O) NH2.
How do you write covalent formulas?
Name the first element first and then the second element by using the stem of the element name plus the suffix -ide. Use numerical prefixes if there is more than one atom of the first element; always use numerical prefixes for the number of atoms of the second element.
What is the common name of C12H22O11?
Sucrose
Sucrose | C12H22O11 – PubChem.
What is C12 H24 o12?
Lactose monohydrate | C12H24O12 – PubChem.
Is dodecene an alkene?
1-Dodecene is an alkene with the formula C10H21CH=CH2, consisting of a chain of twelve carbon atoms ending with a double bond. While there are many isomers of dodecene depending on which carbon the double bond is placed, this isomer is of greater commercial importance. It is classified as an alpha-olefin.